C25H19N5OS — CID 55984553
2-[4-(pyrazol-1-ylmethyl)phenyl]-N-[4-(thiadiazol-4-yl)phenyl]benzamide (PubChem CID 55984553) has the molecular formula C25H19N5OS and a molecular weight of 437.53 g/mol. Its IUPAC name is 2-[4-(pyrazol-1-ylmethyl)phenyl]-N-[4-(thiadiazol-4-yl)phenyl]benzamide.
| Compound Name | 2-[4-(pyrazol-1-ylmethyl)phenyl]-N-[4-(thiadiazol-4-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 55984553 |
| Molecular Formula | C25H19N5OS |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 2-[4-(pyrazol-1-ylmethyl)phenyl]-N-[4-(thiadiazol-4-yl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(-c2csnn2)cc1)c1ccccc1-c1ccc(Cn2cccn2)cc1 |
| InChI | InChI=1S/C25H19N5OS/c31-25(27-21-12-10-20(11-13-21)24-17-32-29-28-24)23-5-2-1-4-22(23)19-8-6-18(7-9-19)16-30-15-3-14-26-30/h1-15,17H,16H2,(H,27,31) |
| InChIKey | GFLGHTIJMUSLJZ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |