C25H24N4O3 — CID 55635479
N-[6-(2-methoxyethoxy)-3-pyridinyl]-2-[4-(pyrazol-1-ylmethyl)phenyl]benzamide (PubChem CID 55635479) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is N-[6-(2-methoxyethoxy)-3-pyridinyl]-2-[4-(pyrazol-1-ylmethyl)phenyl]benzamide.
| Compound Name | N-[6-(2-methoxyethoxy)-3-pyridinyl]-2-[4-(pyrazol-1-ylmethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 55635479 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | N-[6-(2-methoxyethoxy)-3-pyridinyl]-2-[4-(pyrazol-1-ylmethyl)phenyl]benzamide |
| SMILES | COCCOc1ccc(NC(=O)c2ccccc2-c2ccc(Cn3cccn3)cc2)cn1 |
| InChI | InChI=1S/C25H24N4O3/c1-31-15-16-32-24-12-11-21(17-26-24)28-25(30)23-6-3-2-5-22(23)20-9-7-19(8-10-20)18-29-14-4-13-27-29/h2-14,17H,15-16,18H2,1H3,(H,28,30) |
| InChIKey | PVYSBCNFWJOWHT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|