C28H24N4O3 — CID 24684483
N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-2-[4-(pyrazol-1-ylmethyl)phenyl]benzamide (PubChem CID 24684483) has the molecular formula C28H24N4O3 and a molecular weight of 464.53 g/mol. Its IUPAC name is N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-2-[4-(pyrazol-1-ylmethyl)phenyl]benzamide.
| Compound Name | N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-2-[4-(pyrazol-1-ylmethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 24684483 |
| Molecular Formula | C28H24N4O3 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-2-[4-(pyrazol-1-ylmethyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(CN2C(=O)CCC2=O)cc1)c1ccccc1-c1ccc(Cn2cccn2)cc1 |
| InChI | InChI=1S/C28H24N4O3/c33-26-14-15-27(34)32(26)19-21-8-12-23(13-9-21)30-28(35)25-5-2-1-4-24(25)22-10-6-20(7-11-22)18-31-17-3-16-29-31/h1-13,16-17H,14-15,18-19H2,(H,30,35) |
| InChIKey | RWJYDPOASFMQSS-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|