C24H18N2O6 — CID 17342168
2-[3-[[4-[(1,3-dioxoisoindol-2-yl)methyl]benzoyl]amino]phenoxy]acetic acid (PubChem CID 17342168) has the molecular formula C24H18N2O6 and a molecular weight of 430.42 g/mol. Its IUPAC name is 2-[3-[[4-[(1,3-dioxoisoindol-2-yl)methyl]benzoyl]amino]phenoxy]acetic acid.
| Compound Name | 2-[3-[[4-[(1,3-dioxoisoindol-2-yl)methyl]benzoyl]amino]phenoxy]acetic acid |
|---|---|
| PubChem CID | 17342168 |
| Molecular Formula | C24H18N2O6 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 2-[3-[[4-[(1,3-dioxoisoindol-2-yl)methyl]benzoyl]amino]phenoxy]acetic acid |
| SMILES | O=C(O)COc1cccc(NC(=O)c2ccc(CN3C(=O)c4ccccc4C3=O)cc2)c1 |
| InChI | InChI=1S/C24H18N2O6/c27-21(28)14-32-18-5-3-4-17(12-18)25-22(29)16-10-8-15(9-11-16)13-26-23(30)19-6-1-2-7-20(19)24(26)31/h1-12H,13-14H2,(H,25,29)(H,27,28) |
| InChIKey | LVCUWGKIPYDNDJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|