C24H18N2O6 — CID 10252097
3-[[2-[4-[(1,3-dioxoisoindol-2-yl)methyl]phenoxy]acetyl]amino]benzoic acid (PubChem CID 10252097) has the molecular formula C24H18N2O6 and a molecular weight of 430.42 g/mol. Its IUPAC name is 3-[[2-[4-[(1,3-dioxoisoindol-2-yl)methyl]phenoxy]acetyl]amino]benzoic acid.
| Compound Name | 3-[[2-[4-[(1,3-dioxoisoindol-2-yl)methyl]phenoxy]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 10252097 |
| Molecular Formula | C24H18N2O6 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 3-[[2-[4-[(1,3-dioxoisoindol-2-yl)methyl]phenoxy]acetyl]amino]benzoic acid |
| SMILES | O=C(COc1ccc(CN2C(=O)c3ccccc3C2=O)cc1)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C24H18N2O6/c27-21(25-17-5-3-4-16(12-17)24(30)31)14-32-18-10-8-15(9-11-18)13-26-22(28)19-6-1-2-7-20(19)23(26)29/h1-12H,13-14H2,(H,25,27)(H,30,31) |
| InChIKey | BJENPALKSMKSAE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|