C24H17N3O3 — CID 9260427
N-[4-(cyanomethyl)phenyl]-3-[(1,3-dioxoisoindol-2-yl)methyl]benzamide (PubChem CID 9260427) has the molecular formula C24H17N3O3 and a molecular weight of 395.42 g/mol. Its IUPAC name is N-[4-(cyanomethyl)phenyl]-3-[(1,3-dioxoisoindol-2-yl)methyl]benzamide.
| Compound Name | N-[4-(cyanomethyl)phenyl]-3-[(1,3-dioxoisoindol-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 9260427 |
| Molecular Formula | C24H17N3O3 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | N-[4-(cyanomethyl)phenyl]-3-[(1,3-dioxoisoindol-2-yl)methyl]benzamide |
| SMILES | N#CCc1ccc(NC(=O)c2cccc(CN3C(=O)c4ccccc4C3=O)c2)cc1 |
| InChI | InChI=1S/C24H17N3O3/c25-13-12-16-8-10-19(11-9-16)26-22(28)18-5-3-4-17(14-18)15-27-23(29)20-6-1-2-7-21(20)24(27)30/h1-11,14H,12,15H2,(H,26,28) |
| InChIKey | SOIHUBKFMIFEHI-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|