C15H12N4OS — CID 47079830
(E)-1-(1-methylpyrazol-4-yl)-3-(2-pyridin-2-yl-1,3-thiazol-4-yl)prop-2-en-1-one (PubChem CID 47079830) has the molecular formula C15H12N4OS and a molecular weight of 296.36 g/mol. Its IUPAC name is (E)-1-(1-methylpyrazol-4-yl)-3-(2-pyridin-2-yl-1,3-thiazol-4-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(1-methylpyrazol-4-yl)-3-(2-pyridin-2-yl-1,3-thiazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 47079830 |
| Molecular Formula | C15H12N4OS |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | (E)-1-(1-methylpyrazol-4-yl)-3-(2-pyridin-2-yl-1,3-thiazol-4-yl)prop-2-en-1-one |
| SMILES | Cn1cc(C(=O)/C=C/c2csc(-c3ccccn3)n2)cn1 |
| InChI | InChI=1S/C15H12N4OS/c1-19-9-11(8-17-19)14(20)6-5-12-10-21-15(18-12)13-4-2-3-7-16-13/h2-10H,1H3/b6-5+ |
| InChIKey | KAIVPYFFYKINPJ-AATRIKPKSA-N |
| XLogP | 2.83 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|