C15H10N2OS2 — CID 56824797
(E)-1-pyridin-3-yl-3-(2-thiophen-2-yl-1,3-thiazol-4-yl)prop-2-en-1-one (PubChem CID 56824797) has the molecular formula C15H10N2OS2 and a molecular weight of 298.39 g/mol. Its IUPAC name is (E)-1-pyridin-3-yl-3-(2-thiophen-2-yl-1,3-thiazol-4-yl)prop-2-en-1-one.
| Compound Name | (E)-1-pyridin-3-yl-3-(2-thiophen-2-yl-1,3-thiazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 56824797 |
| Molecular Formula | C15H10N2OS2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | (E)-1-pyridin-3-yl-3-(2-thiophen-2-yl-1,3-thiazol-4-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1csc(-c2cccs2)n1)c1cccnc1 |
| InChI | InChI=1S/C15H10N2OS2/c18-13(11-3-1-7-16-9-11)6-5-12-10-20-15(17-12)14-4-2-8-19-14/h1-10H/b6-5+ |
| InChIKey | JXEWZKWRYMFXJW-AATRIKPKSA-N |
| XLogP | 4.16 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|