C22H17N3OS — CID 8854297
(E)-3-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)-1-pyridin-3-ylprop-2-en-1-one (PubChem CID 8854297) has the molecular formula C22H17N3OS and a molecular weight of 371.47 g/mol. Its IUPAC name is (E)-3-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)-1-pyridin-3-ylprop-2-en-1-one.
| Compound Name | (E)-3-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)-1-pyridin-3-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 8854297 |
| Molecular Formula | C22H17N3OS |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | (E)-3-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)-1-pyridin-3-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1cn(Cc2ccccc2)nc1-c1cccs1)c1cccnc1 |
| InChI | InChI=1S/C22H17N3OS/c26-20(18-8-4-12-23-14-18)11-10-19-16-25(15-17-6-2-1-3-7-17)24-22(19)21-9-5-13-27-21/h1-14,16H,15H2/b11-10+ |
| InChIKey | LZUFEZASUFJTBV-ZHACJKMWSA-N |
| XLogP | 4.95 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|