C17H15N5O2S — CID 9120952
N'-[(Z)-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]oxamide (PubChem CID 9120952) has the molecular formula C17H15N5O2S and a molecular weight of 353.41 g/mol. Its IUPAC name is N'-[(Z)-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]oxamide.
| Compound Name | N'-[(Z)-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 9120952 |
| Molecular Formula | C17H15N5O2S |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | N'-[(Z)-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]oxamide |
| SMILES | NC(=O)C(=O)N/N=C\c1cn(Cc2ccccc2)nc1-c1cccs1 |
| InChI | InChI=1S/C17H15N5O2S/c18-16(23)17(24)20-19-9-13-11-22(10-12-5-2-1-3-6-12)21-15(13)14-7-4-8-25-14/h1-9,11H,10H2,(H2,18,23)(H,20,24)/b19-9- |
| InChIKey | YOONIJHLTWOKLL-OCKHKDLRSA-N |
| XLogP | 1.60 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|