C22H19N5O3S — CID 75535880
5-[[[(E)-3-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enoyl]amino]methyl]-1,2-oxazole-3-carboxamide (PubChem CID 75535880) has the molecular formula C22H19N5O3S and a molecular weight of 433.49 g/mol. Its IUPAC name is 5-[[[(E)-3-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enoyl]amino]methyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-[[[(E)-3-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enoyl]amino]methyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 75535880 |
| Molecular Formula | C22H19N5O3S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 5-[[[(E)-3-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enoyl]amino]methyl]-1,2-oxazole-3-carboxamide |
| SMILES | NC(=O)c1cc(CNC(=O)/C=C/c2cn(Cc3ccccc3)nc2-c2cccs2)on1 |
| InChI | InChI=1S/C22H19N5O3S/c23-22(29)18-11-17(30-26-18)12-24-20(28)9-8-16-14-27(13-15-5-2-1-3-6-15)25-21(16)19-7-4-10-31-19/h1-11,14H,12-13H2,(H2,23,29)(H,24,28)/b9-8+ |
| InChIKey | XHNGYBOXPNPKAN-CMDGGOBGSA-N |
| XLogP | 3.08 |
| TPSA | 116.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|