C26H28N6O2S — CID 55968082
3-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]prop-2-enamide (PubChem CID 55968082) has the molecular formula C26H28N6O2S and a molecular weight of 488.62 g/mol. Its IUPAC name is 3-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]prop-2-enamide.
| Compound Name | 3-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 55968082 |
| Molecular Formula | C26H28N6O2S |
| Molecular Weight | 488.62 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | 3-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]prop-2-enamide |
| SMILES | O=C(C=Cc1cn(Cc2ccccc2)nc1-c1cccs1)NCCCn1nc2n(c1=O)CCCC2 |
| InChI | InChI=1S/C26H28N6O2S/c33-24(27-14-7-16-32-26(34)31-15-5-4-11-23(31)28-32)13-12-21-19-30(18-20-8-2-1-3-9-20)29-25(21)22-10-6-17-35-22/h1-3,6,8-10,12-13,17,19H,4-5,7,11,14-16,18H2,(H,27,33) |
| InChIKey | RESRQURTPWHDLH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 86.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.62 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|