C27H26N4O3S — CID 46539697
(E)-3-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)-N-[1-(furan-3-carbonyl)piperidin-4-yl]prop-2-enamide (PubChem CID 46539697) has the molecular formula C27H26N4O3S and a molecular weight of 486.60 g/mol. Its IUPAC name is (E)-3-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)-N-[1-(furan-3-carbonyl)piperidin-4-yl]prop-2-enamide.
| Compound Name | (E)-3-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)-N-[1-(furan-3-carbonyl)piperidin-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 46539697 |
| Molecular Formula | C27H26N4O3S |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | (E)-3-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)-N-[1-(furan-3-carbonyl)piperidin-4-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cn(Cc2ccccc2)nc1-c1cccs1)NC1CCN(C(=O)c2ccoc2)CC1 |
| InChI | InChI=1S/C27H26N4O3S/c32-25(28-23-10-13-30(14-11-23)27(33)22-12-15-34-19-22)9-8-21-18-31(17-20-5-2-1-3-6-20)29-26(21)24-7-4-16-35-24/h1-9,12,15-16,18-19,23H,10-11,13-14,17H2,(H,28,32)/b9-8+ |
| InChIKey | LPGRTQCTBPERDV-CMDGGOBGSA-N |
| XLogP | 4.69 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|