C23H22N4OS — CID 51531787
(E)-3-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)-2-cyano-N-cyclopentylprop-2-enamide (PubChem CID 51531787) has the molecular formula C23H22N4OS and a molecular weight of 402.52 g/mol. Its IUPAC name is (E)-3-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)-2-cyano-N-cyclopentylprop-2-enamide.
| Compound Name | (E)-3-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)-2-cyano-N-cyclopentylprop-2-enamide |
|---|---|
| PubChem CID | 51531787 |
| Molecular Formula | C23H22N4OS |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | (E)-3-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)-2-cyano-N-cyclopentylprop-2-enamide |
| SMILES | N#C/C(=C\c1cn(Cc2ccccc2)nc1-c1cccs1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C23H22N4OS/c24-14-18(23(28)25-20-9-4-5-10-20)13-19-16-27(15-17-7-2-1-3-8-17)26-22(19)21-11-6-12-29-21/h1-3,6-8,11-13,16,20H,4-5,9-10,15H2,(H,25,28)/b18-13+ |
| InChIKey | PQWUQAWYNDYMAP-QGOAFFKASA-N |
| XLogP | 4.63 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|