C22H23N5O — CID 8862067
(E)-2-cyano-3-[1-(2-cyanoethyl)-3-phenylpyrazol-4-yl]-N-cyclohexylprop-2-enamide (PubChem CID 8862067) has the molecular formula C22H23N5O and a molecular weight of 373.46 g/mol. Its IUPAC name is (E)-2-cyano-3-[1-(2-cyanoethyl)-3-phenylpyrazol-4-yl]-N-cyclohexylprop-2-enamide.
| Compound Name | (E)-2-cyano-3-[1-(2-cyanoethyl)-3-phenylpyrazol-4-yl]-N-cyclohexylprop-2-enamide |
|---|---|
| PubChem CID | 8862067 |
| Molecular Formula | C22H23N5O |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | (E)-2-cyano-3-[1-(2-cyanoethyl)-3-phenylpyrazol-4-yl]-N-cyclohexylprop-2-enamide |
| SMILES | N#CCCn1cc(/C=C(\C#N)C(=O)NC2CCCCC2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H23N5O/c23-12-7-13-27-16-19(21(26-27)17-8-3-1-4-9-17)14-18(15-24)22(28)25-20-10-5-2-6-11-20/h1,3-4,8-9,14,16,20H,2,5-7,10-11,13H2,(H,25,28)/b18-14+ |
| InChIKey | GIJCJTZKXXUYNH-NBVRZTHBSA-N |
| XLogP | 3.82 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|