C18H18N6O2 — CID 9352466
N'-[(Z)-[1-(2-cyanoethyl)-3-phenylpyrazol-4-yl]methylideneamino]-N-cyclopropyloxamide (PubChem CID 9352466) has the molecular formula C18H18N6O2 and a molecular weight of 350.38 g/mol. Its IUPAC name is N'-[(Z)-[1-(2-cyanoethyl)-3-phenylpyrazol-4-yl]methylideneamino]-N-cyclopropyloxamide.
| Compound Name | N'-[(Z)-[1-(2-cyanoethyl)-3-phenylpyrazol-4-yl]methylideneamino]-N-cyclopropyloxamide |
|---|---|
| PubChem CID | 9352466 |
| Molecular Formula | C18H18N6O2 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | N'-[(Z)-[1-(2-cyanoethyl)-3-phenylpyrazol-4-yl]methylideneamino]-N-cyclopropyloxamide |
| SMILES | N#CCCn1cc(/C=N\NC(=O)C(=O)NC2CC2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H18N6O2/c19-9-4-10-24-12-14(16(23-24)13-5-2-1-3-6-13)11-20-22-18(26)17(25)21-15-7-8-15/h1-3,5-6,11-12,15H,4,7-8,10H2,(H,21,25)(H,22,26)/b20-11- |
| InChIKey | CWIQOKFDNCNZOI-JAIQZWGSSA-N |
| XLogP | 1.19 |
| TPSA | 112.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|