C22H15N3O2 — CID 8855126
3-[4-[(1,3-dioxoinden-2-ylidene)methyl]-3-phenylpyrazol-1-yl]propanenitrile (PubChem CID 8855126) has the molecular formula C22H15N3O2 and a molecular weight of 353.38 g/mol. Its IUPAC name is 3-[4-[(1,3-dioxoinden-2-ylidene)methyl]-3-phenylpyrazol-1-yl]propanenitrile.
| Compound Name | 3-[4-[(1,3-dioxoinden-2-ylidene)methyl]-3-phenylpyrazol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 8855126 |
| Molecular Formula | C22H15N3O2 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 3-[4-[(1,3-dioxoinden-2-ylidene)methyl]-3-phenylpyrazol-1-yl]propanenitrile |
| SMILES | N#CCCn1cc(C=C2C(=O)c3ccccc3C2=O)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H15N3O2/c23-11-6-12-25-14-16(20(24-25)15-7-2-1-3-8-15)13-19-21(26)17-9-4-5-10-18(17)22(19)27/h1-5,7-10,13-14H,6,12H2 |
| InChIKey | IULICTYOIQSTGO-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 75.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|