C22H17N5OS — CID 6368565
3-[4-[(E)-(5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-ylidene)methyl]-3-phenylpyrazol-1-yl]propanenitrile (PubChem CID 6368565) has the molecular formula C22H17N5OS and a molecular weight of 399.48 g/mol. Its IUPAC name is 3-[4-[(E)-(5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-ylidene)methyl]-3-phenylpyrazol-1-yl]propanenitrile.
| Compound Name | 3-[4-[(E)-(5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-ylidene)methyl]-3-phenylpyrazol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 6368565 |
| Molecular Formula | C22H17N5OS |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 3-[4-[(E)-(5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-ylidene)methyl]-3-phenylpyrazol-1-yl]propanenitrile |
| SMILES | N#CCCn1cc(/C=C2/NC(=S)N(c3ccccc3)C2=O)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H17N5OS/c23-12-7-13-26-15-17(20(25-26)16-8-3-1-4-9-16)14-19-21(28)27(22(29)24-19)18-10-5-2-6-11-18/h1-6,8-11,14-15H,7,13H2,(H,24,29)/b19-14+ |
| InChIKey | HQILKFVMRWJWFC-XMHGGMMESA-N |
| XLogP | 3.73 |
| TPSA | 73.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|