C16H10N3O4S- — CID 7431468
4-nitro-2-[(Z)-(5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenolate (PubChem CID 7431468) has the molecular formula C16H10N3O4S- and a molecular weight of 340.34 g/mol. Its IUPAC name is 4-nitro-2-[(Z)-(5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenolate.
| Compound Name | 4-nitro-2-[(Z)-(5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenolate |
|---|---|
| PubChem CID | 7431468 |
| Molecular Formula | C16H10N3O4S- |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 4-nitro-2-[(Z)-(5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenolate |
| SMILES | O=C1/C(=C/c2cc([N+](=O)[O-])ccc2[O-])NC(=S)N1c1ccccc1 |
| InChI | InChI=1S/C16H11N3O4S/c20-14-7-6-12(19(22)23)8-10(14)9-13-15(21)18(16(24)17-13)11-4-2-1-3-5-11/h1-9,20H,(H,17,24)/p-1/b13-9- |
| InChIKey | HBKDIINMVXTTNE-LCYFTJDESA-M |
| XLogP | 1.93 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|