C22H17N5S — CID 2900619
2-cyano-3-[1-(2-cyanoethyl)-3-(4-phenylphenyl)pyrazol-4-yl]prop-2-enethioamide (PubChem CID 2900619) has the molecular formula C22H17N5S and a molecular weight of 383.48 g/mol. Its IUPAC name is 2-cyano-3-[1-(2-cyanoethyl)-3-(4-phenylphenyl)pyrazol-4-yl]prop-2-enethioamide.
| Compound Name | 2-cyano-3-[1-(2-cyanoethyl)-3-(4-phenylphenyl)pyrazol-4-yl]prop-2-enethioamide |
|---|---|
| PubChem CID | 2900619 |
| Molecular Formula | C22H17N5S |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 2-cyano-3-[1-(2-cyanoethyl)-3-(4-phenylphenyl)pyrazol-4-yl]prop-2-enethioamide |
| SMILES | N#CCCn1cc(C=C(C#N)C(N)=S)c(-c2ccc(-c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C22H17N5S/c23-11-4-12-27-15-20(13-19(14-24)22(25)28)21(26-27)18-9-7-17(8-10-18)16-5-2-1-3-6-16/h1-3,5-10,13,15H,4,12H2,(H2,25,28) |
| InChIKey | RZOUVDVTYWAPJH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|