C22H17ClN4O2 — CID 31323430
3-[4-[(E)-(6-chloro-2-oxo-1H-indol-3-ylidene)methyl]-3-(4-methoxyphenyl)pyrazol-1-yl]propanenitrile (PubChem CID 31323430) has the molecular formula C22H17ClN4O2 and a molecular weight of 404.86 g/mol. Its IUPAC name is 3-[4-[(E)-(6-chloro-2-oxo-1H-indol-3-ylidene)methyl]-3-(4-methoxyphenyl)pyrazol-1-yl]propanenitrile.
| Compound Name | 3-[4-[(E)-(6-chloro-2-oxo-1H-indol-3-ylidene)methyl]-3-(4-methoxyphenyl)pyrazol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 31323430 |
| Molecular Formula | C22H17ClN4O2 |
| Molecular Weight | 404.86 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 3-[4-[(E)-(6-chloro-2-oxo-1H-indol-3-ylidene)methyl]-3-(4-methoxyphenyl)pyrazol-1-yl]propanenitrile |
| SMILES | COc1ccc(-c2nn(CCC#N)cc2/C=C2/C(=O)Nc3cc(Cl)ccc32)cc1 |
| InChI | InChI=1S/C22H17ClN4O2/c1-29-17-6-3-14(4-7-17)21-15(13-27(26-21)10-2-9-24)11-19-18-8-5-16(23)12-20(18)25-22(19)28/h3-8,11-13H,2,10H2,1H3,(H,25,28)/b19-11+ |
| InChIKey | USTAREFBNKSWDP-YBFXNURJSA-N |
| XLogP | 4.62 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.86 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|