C13H10ClN3O2 — CID 6488245
3-(4-chlorophenyl)-1-(2-cyanoethyl)pyrazole-4-carboxylic acid (PubChem CID 6488245) has the molecular formula C13H10ClN3O2 and a molecular weight of 275.70 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-(2-cyanoethyl)pyrazole-4-carboxylic acid.
| Compound Name | 3-(4-chlorophenyl)-1-(2-cyanoethyl)pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 6488245 |
| Molecular Formula | C13H10ClN3O2 |
| Molecular Weight | 275.70 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 3-(4-chlorophenyl)-1-(2-cyanoethyl)pyrazole-4-carboxylic acid |
| SMILES | N#CCCn1cc(C(=O)O)c(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C13H10ClN3O2/c14-10-4-2-9(3-5-10)12-11(13(18)19)8-17(16-12)7-1-6-15/h2-5,8H,1,7H2,(H,18,19) |
| InChIKey | YLDNIEKBDXRSCM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.70 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |