C14H12ClN3O2 — CID 27109061
methyl 3-(3-chlorophenyl)-1-(2-cyanoethyl)pyrazole-4-carboxylate (PubChem CID 27109061) has the molecular formula C14H12ClN3O2 and a molecular weight of 289.72 g/mol. Its IUPAC name is methyl 3-(3-chlorophenyl)-1-(2-cyanoethyl)pyrazole-4-carboxylate.
| Compound Name | methyl 3-(3-chlorophenyl)-1-(2-cyanoethyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 27109061 |
| Molecular Formula | C14H12ClN3O2 |
| Molecular Weight | 289.72 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | methyl 3-(3-chlorophenyl)-1-(2-cyanoethyl)pyrazole-4-carboxylate |
| SMILES | COC(=O)c1cn(CCC#N)nc1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H12ClN3O2/c1-20-14(19)12-9-18(7-3-6-16)17-13(12)10-4-2-5-11(15)8-10/h2,4-5,8-9H,3,7H2,1H3 |
| InChIKey | QUGDKFSQGATNGT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.72 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |