C20H17IN4O2 — CID 2489959
1-(2-cyanoethyl)-N-(4-iodophenyl)-3-(3-methoxyphenyl)pyrazole-4-carboxamide (PubChem CID 2489959) has the molecular formula C20H17IN4O2 and a molecular weight of 472.29 g/mol. Its IUPAC name is 1-(2-cyanoethyl)-N-(4-iodophenyl)-3-(3-methoxyphenyl)pyrazole-4-carboxamide.
| Compound Name | 1-(2-cyanoethyl)-N-(4-iodophenyl)-3-(3-methoxyphenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 2489959 |
| Molecular Formula | C20H17IN4O2 |
| Molecular Weight | 472.29 g/mol |
| Exact Mass | 472.04 |
| IUPAC Name | 1-(2-cyanoethyl)-N-(4-iodophenyl)-3-(3-methoxyphenyl)pyrazole-4-carboxamide |
| SMILES | COc1cccc(-c2nn(CCC#N)cc2C(=O)Nc2ccc(I)cc2)c1 |
| InChI | InChI=1S/C20H17IN4O2/c1-27-17-5-2-4-14(12-17)19-18(13-25(24-19)11-3-10-22)20(26)23-16-8-6-15(21)7-9-16/h2,4-9,12-13H,3,11H2,1H3,(H,23,26) |
| InChIKey | FQTKTBBJBHYDNM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.29 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|