C23H22N4O4 — CID 2529442
ethyl 4-[[1-(2-cyanoethyl)-3-(4-methoxyphenyl)pyrazole-4-carbonyl]amino]benzoate (PubChem CID 2529442) has the molecular formula C23H22N4O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is ethyl 4-[[1-(2-cyanoethyl)-3-(4-methoxyphenyl)pyrazole-4-carbonyl]amino]benzoate.
| Compound Name | ethyl 4-[[1-(2-cyanoethyl)-3-(4-methoxyphenyl)pyrazole-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 2529442 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | ethyl 4-[[1-(2-cyanoethyl)-3-(4-methoxyphenyl)pyrazole-4-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2cn(CCC#N)nc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H22N4O4/c1-3-31-23(29)17-5-9-18(10-6-17)25-22(28)20-15-27(14-4-13-24)26-21(20)16-7-11-19(30-2)12-8-16/h5-12,15H,3-4,14H2,1-2H3,(H,25,28) |
| InChIKey | HJQVRVDYMSAUGU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 106.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |