C19H16N4O2S — CID 6483972
N-(4-acetylphenyl)-1-(2-cyanoethyl)-3-thiophen-2-ylpyrazole-4-carboxamide (PubChem CID 6483972) has the molecular formula C19H16N4O2S and a molecular weight of 364.43 g/mol. Its IUPAC name is N-(4-acetylphenyl)-1-(2-cyanoethyl)-3-thiophen-2-ylpyrazole-4-carboxamide.
| Compound Name | N-(4-acetylphenyl)-1-(2-cyanoethyl)-3-thiophen-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 6483972 |
| Molecular Formula | C19H16N4O2S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | N-(4-acetylphenyl)-1-(2-cyanoethyl)-3-thiophen-2-ylpyrazole-4-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)c2cn(CCC#N)nc2-c2cccs2)cc1 |
| InChI | InChI=1S/C19H16N4O2S/c1-13(24)14-5-7-15(8-6-14)21-19(25)16-12-23(10-3-9-20)22-18(16)17-4-2-11-26-17/h2,4-8,11-12H,3,10H2,1H3,(H,21,25) |
| InChIKey | FUNOXGRYJDAHTP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |