C19H14IN5O3 — CID 2534939
1-(2-cyanoethyl)-N-(4-iodophenyl)-3-(4-nitrophenyl)pyrazole-4-carboxamide (PubChem CID 2534939) has the molecular formula C19H14IN5O3 and a molecular weight of 487.26 g/mol. Its IUPAC name is 1-(2-cyanoethyl)-N-(4-iodophenyl)-3-(4-nitrophenyl)pyrazole-4-carboxamide.
| Compound Name | 1-(2-cyanoethyl)-N-(4-iodophenyl)-3-(4-nitrophenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 2534939 |
| Molecular Formula | C19H14IN5O3 |
| Molecular Weight | 487.26 g/mol |
| Exact Mass | 487.01 |
| IUPAC Name | 1-(2-cyanoethyl)-N-(4-iodophenyl)-3-(4-nitrophenyl)pyrazole-4-carboxamide |
| SMILES | N#CCCn1cc(C(=O)Nc2ccc(I)cc2)c(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C19H14IN5O3/c20-14-4-6-15(7-5-14)22-19(26)17-12-24(11-1-10-21)23-18(17)13-2-8-16(9-3-13)25(27)28/h2-9,12H,1,11H2,(H,22,26) |
| InChIKey | TVNCDDGQZUFBFG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 113.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.26 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|