C18H14FN5O4 — CID 94491182
N-(3-carbamoyl-4-fluorophenyl)-1-methyl-3-(4-nitrophenyl)pyrazole-4-carboxamide (PubChem CID 94491182) has the molecular formula C18H14FN5O4 and a molecular weight of 383.34 g/mol. Its IUPAC name is N-(3-carbamoyl-4-fluorophenyl)-1-methyl-3-(4-nitrophenyl)pyrazole-4-carboxamide.
| Compound Name | N-(3-carbamoyl-4-fluorophenyl)-1-methyl-3-(4-nitrophenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 94491182 |
| Molecular Formula | C18H14FN5O4 |
| Molecular Weight | 383.34 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | N-(3-carbamoyl-4-fluorophenyl)-1-methyl-3-(4-nitrophenyl)pyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)Nc2ccc(F)c(C(N)=O)c2)c(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C18H14FN5O4/c1-23-9-14(16(22-23)10-2-5-12(6-3-10)24(27)28)18(26)21-11-4-7-15(19)13(8-11)17(20)25/h2-9H,1H3,(H2,20,25)(H,21,26) |
| InChIKey | YUUUHAUEJGTKPP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 133.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|