C24H18N4O5 — CID 166792153
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(4-nitrophenyl)-1-phenylpyrazole-4-carboxamide (PubChem CID 166792153) has the molecular formula C24H18N4O5 and a molecular weight of 442.43 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(4-nitrophenyl)-1-phenylpyrazole-4-carboxamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(4-nitrophenyl)-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 166792153 |
| Molecular Formula | C24H18N4O5 |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(4-nitrophenyl)-1-phenylpyrazole-4-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCCO2)c1cn(-c2ccccc2)nc1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H18N4O5/c29-24(25-17-8-11-21-22(14-17)33-13-12-32-21)20-15-27(18-4-2-1-3-5-18)26-23(20)16-6-9-19(10-7-16)28(30)31/h1-11,14-15H,12-13H2,(H,25,29) |
| InChIKey | ISKMCVFZYYNBEA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|