C18H14N4O5S — CID 4739458
2-amino-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-(4-nitrophenyl)-1,3-thiazole-5-carboxamide (PubChem CID 4739458) has the molecular formula C18H14N4O5S and a molecular weight of 398.40 g/mol. Its IUPAC name is 2-amino-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-(4-nitrophenyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-amino-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-(4-nitrophenyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 4739458 |
| Molecular Formula | C18H14N4O5S |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 2-amino-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-(4-nitrophenyl)-1,3-thiazole-5-carboxamide |
| SMILES | Nc1nc(-c2ccc([N+](=O)[O-])cc2)c(C(=O)Nc2ccc3c(c2)OCCO3)s1 |
| InChI | InChI=1S/C18H14N4O5S/c19-18-21-15(10-1-4-12(5-2-10)22(24)25)16(28-18)17(23)20-11-3-6-13-14(9-11)27-8-7-26-13/h1-6,9H,7-8H2,(H2,19,21)(H,20,23) |
| InChIKey | GCDWOUUBQKEBRM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 129.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|