C18H14N2O5S — CID 42150971
N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-5-nitro-1-benzothiophene-2-carboxamide (PubChem CID 42150971) has the molecular formula C18H14N2O5S and a molecular weight of 370.39 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-5-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-5-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 42150971 |
| Molecular Formula | C18H14N2O5S |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-5-nitro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCCCO2)c1cc2cc([N+](=O)[O-])ccc2s1 |
| InChI | InChI=1S/C18H14N2O5S/c21-18(17-9-11-8-13(20(22)23)3-5-16(11)26-17)19-12-2-4-14-15(10-12)25-7-1-6-24-14/h2-5,8-10H,1,6-7H2,(H,19,21) |
| InChIKey | TUBOPDLIHNOTPL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|