C24H18N2O7S2 — CID 4687357
methyl 5-(1,3-benzodioxol-5-ylmethyl)-4-methyl-2-[(5-nitro-1-benzothiophene-2-carbonyl)amino]thiophene-3-carboxylate (PubChem CID 4687357) has the molecular formula C24H18N2O7S2 and a molecular weight of 510.55 g/mol. Its IUPAC name is methyl 5-(1,3-benzodioxol-5-ylmethyl)-4-methyl-2-[(5-nitro-1-benzothiophene-2-carbonyl)amino]thiophene-3-carboxylate.
| Compound Name | methyl 5-(1,3-benzodioxol-5-ylmethyl)-4-methyl-2-[(5-nitro-1-benzothiophene-2-carbonyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4687357 |
| Molecular Formula | C24H18N2O7S2 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.06 |
| IUPAC Name | methyl 5-(1,3-benzodioxol-5-ylmethyl)-4-methyl-2-[(5-nitro-1-benzothiophene-2-carbonyl)amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)c2cc3cc([N+](=O)[O-])ccc3s2)sc(Cc2ccc3c(c2)OCO3)c1C |
| InChI | InChI=1S/C24H18N2O7S2/c1-12-19(8-13-3-5-16-17(7-13)33-11-32-16)35-23(21(12)24(28)31-2)25-22(27)20-10-14-9-15(26(29)30)4-6-18(14)34-20/h3-7,9-10H,8,11H2,1-2H3,(H,25,27) |
| InChIKey | USCSQDKKSWAVGX-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|