C23H20N2O7S2 — CID 5215008
ethyl 5-(1,3-benzodioxol-5-ylmethyl)-4-methyl-2-[3-(5-nitrothiophen-2-yl)prop-2-enoylamino]thiophene-3-carboxylate (PubChem CID 5215008) has the molecular formula C23H20N2O7S2 and a molecular weight of 500.55 g/mol. Its IUPAC name is ethyl 5-(1,3-benzodioxol-5-ylmethyl)-4-methyl-2-[3-(5-nitrothiophen-2-yl)prop-2-enoylamino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-(1,3-benzodioxol-5-ylmethyl)-4-methyl-2-[3-(5-nitrothiophen-2-yl)prop-2-enoylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 5215008 |
| Molecular Formula | C23H20N2O7S2 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.07 |
| IUPAC Name | ethyl 5-(1,3-benzodioxol-5-ylmethyl)-4-methyl-2-[3-(5-nitrothiophen-2-yl)prop-2-enoylamino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C=Cc2ccc([N+](=O)[O-])s2)sc(Cc2ccc3c(c2)OCO3)c1C |
| InChI | InChI=1S/C23H20N2O7S2/c1-3-30-23(27)21-13(2)18(11-14-4-7-16-17(10-14)32-12-31-16)34-22(21)24-19(26)8-5-15-6-9-20(33-15)25(28)29/h4-10H,3,11-12H2,1-2H3,(H,24,26) |
| InChIKey | NBTKZSBAAGHHBL-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|