C13H9N3O4S — CID 959031
N-(5-methyl-1,2-oxazol-3-yl)-5-nitro-1-benzothiophene-2-carboxamide (PubChem CID 959031) has the molecular formula C13H9N3O4S and a molecular weight of 303.30 g/mol. Its IUPAC name is N-(5-methyl-1,2-oxazol-3-yl)-5-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-(5-methyl-1,2-oxazol-3-yl)-5-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 959031 |
| Molecular Formula | C13H9N3O4S |
| Molecular Weight | 303.30 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | N-(5-methyl-1,2-oxazol-3-yl)-5-nitro-1-benzothiophene-2-carboxamide |
| SMILES | Cc1cc(NC(=O)c2cc3cc([N+](=O)[O-])ccc3s2)no1 |
| InChI | InChI=1S/C13H9N3O4S/c1-7-4-12(15-20-7)14-13(17)11-6-8-5-9(16(18)19)2-3-10(8)21-11/h2-6H,1H3,(H,14,15,17) |
| InChIKey | BPVHOPLRXQCQBY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.30 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|