C17H15N3O5S2 — CID 24646804
N-[4-methyl-3-(methylsulfamoyl)phenyl]-5-nitro-1-benzothiophene-2-carboxamide (PubChem CID 24646804) has the molecular formula C17H15N3O5S2 and a molecular weight of 405.46 g/mol. Its IUPAC name is N-[4-methyl-3-(methylsulfamoyl)phenyl]-5-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[4-methyl-3-(methylsulfamoyl)phenyl]-5-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 24646804 |
| Molecular Formula | C17H15N3O5S2 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | N-[4-methyl-3-(methylsulfamoyl)phenyl]-5-nitro-1-benzothiophene-2-carboxamide |
| SMILES | CNS(=O)(=O)c1cc(NC(=O)c2cc3cc([N+](=O)[O-])ccc3s2)ccc1C |
| InChI | InChI=1S/C17H15N3O5S2/c1-10-3-4-12(9-16(10)27(24,25)18-2)19-17(21)15-8-11-7-13(20(22)23)5-6-14(11)26-15/h3-9,18H,1-2H3,(H,19,21) |
| InChIKey | KFNLIAHUIVCKSX-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|