C18H12N4O4S — CID 16854540
N-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]-5-nitro-1-benzothiophene-2-carboxamide (PubChem CID 16854540) has the molecular formula C18H12N4O4S and a molecular weight of 380.39 g/mol. Its IUPAC name is N-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]-5-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]-5-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 16854540 |
| Molecular Formula | C18H12N4O4S |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | N-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]-5-nitro-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc(-c2nnc(NC(=O)c3cc4cc([N+](=O)[O-])ccc4s3)o2)cc1 |
| InChI | InChI=1S/C18H12N4O4S/c1-10-2-4-11(5-3-10)17-20-21-18(26-17)19-16(23)15-9-12-8-13(22(24)25)6-7-14(12)27-15/h2-9H,1H3,(H,19,21,23) |
| InChIKey | AFXAAWABQJBXEA-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|