C18H11ClN4O4S — CID 45018417
3-chloro-6-methyl-N-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]-1-benzothiophene-2-carboxamide (PubChem CID 45018417) has the molecular formula C18H11ClN4O4S and a molecular weight of 414.83 g/mol. Its IUPAC name is 3-chloro-6-methyl-N-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-6-methyl-N-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 45018417 |
| Molecular Formula | C18H11ClN4O4S |
| Molecular Weight | 414.83 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | 3-chloro-6-methyl-N-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc2c(Cl)c(C(=O)Nc3nnc(-c4ccc([N+](=O)[O-])cc4)o3)sc2c1 |
| InChI | InChI=1S/C18H11ClN4O4S/c1-9-2-7-12-13(8-9)28-15(14(12)19)16(24)20-18-22-21-17(27-18)10-3-5-11(6-4-10)23(25)26/h2-8H,1H3,(H,20,22,24) |
| InChIKey | HRLQAXWTRZKARR-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.83 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|