C24H13Cl2N5O5S — CID 45020980
3,6-dichloro-N-[3-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]carbamoyl]phenyl]-1-benzothiophene-2-carboxamide (PubChem CID 45020980) has the molecular formula C24H13Cl2N5O5S and a molecular weight of 554.37 g/mol. Its IUPAC name is 3,6-dichloro-N-[3-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]carbamoyl]phenyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3,6-dichloro-N-[3-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]carbamoyl]phenyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 45020980 |
| Molecular Formula | C24H13Cl2N5O5S |
| Molecular Weight | 554.37 g/mol |
| Exact Mass | 553.00 |
| IUPAC Name | 3,6-dichloro-N-[3-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]carbamoyl]phenyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(Nc1nnc(-c2ccc([N+](=O)[O-])cc2)o1)c1cccc(NC(=O)c2sc3cc(Cl)ccc3c2Cl)c1 |
| InChI | InChI=1S/C24H13Cl2N5O5S/c25-14-6-9-17-18(11-14)37-20(19(17)26)22(33)27-15-3-1-2-13(10-15)21(32)28-24-30-29-23(36-24)12-4-7-16(8-5-12)31(34)35/h1-11H,(H,27,33)(H,28,30,32) |
| InChIKey | PVPUOUGIAXXWSO-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.37 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|