C18H13Cl3N4O4 — CID 45010959
N-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-3-[(2,2,2-trichloroacetyl)amino]benzamide (PubChem CID 45010959) has the molecular formula C18H13Cl3N4O4 and a molecular weight of 455.69 g/mol. Its IUPAC name is N-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-3-[(2,2,2-trichloroacetyl)amino]benzamide.
| Compound Name | N-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-3-[(2,2,2-trichloroacetyl)amino]benzamide |
|---|---|
| PubChem CID | 45010959 |
| Molecular Formula | C18H13Cl3N4O4 |
| Molecular Weight | 455.69 g/mol |
| Exact Mass | 454.00 |
| IUPAC Name | N-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-3-[(2,2,2-trichloroacetyl)amino]benzamide |
| SMILES | COc1ccc(-c2nnc(NC(=O)c3cccc(NC(=O)C(Cl)(Cl)Cl)c3)o2)cc1 |
| InChI | InChI=1S/C18H13Cl3N4O4/c1-28-13-7-5-10(6-8-13)15-24-25-17(29-15)23-14(26)11-3-2-4-12(9-11)22-16(27)18(19,20)21/h2-9H,1H3,(H,22,27)(H,23,25,26) |
| InChIKey | FTMAFRJMMZCTJE-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.69 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|