C18H16N4O4 — CID 45017389
ethyl N-[3-[(5-phenyl-1,3,4-oxadiazol-2-yl)carbamoyl]phenyl]carbamate (PubChem CID 45017389) has the molecular formula C18H16N4O4 and a molecular weight of 352.35 g/mol. Its IUPAC name is ethyl N-[3-[(5-phenyl-1,3,4-oxadiazol-2-yl)carbamoyl]phenyl]carbamate.
| Compound Name | ethyl N-[3-[(5-phenyl-1,3,4-oxadiazol-2-yl)carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 45017389 |
| Molecular Formula | C18H16N4O4 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | ethyl N-[3-[(5-phenyl-1,3,4-oxadiazol-2-yl)carbamoyl]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1cccc(C(=O)Nc2nnc(-c3ccccc3)o2)c1 |
| InChI | InChI=1S/C18H16N4O4/c1-2-25-18(24)19-14-10-6-9-13(11-14)15(23)20-17-22-21-16(26-17)12-7-4-3-5-8-12/h3-11H,2H2,1H3,(H,19,24)(H,20,22,23) |
| InChIKey | VOWHUWHJCSLRMQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |