C10H10N4O3 — CID 71521216
[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]urea (PubChem CID 71521216) has the molecular formula C10H10N4O3 and a molecular weight of 234.22 g/mol. Its IUPAC name is [5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]urea.
| Compound Name | [5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]urea |
|---|---|
| PubChem CID | 71521216 |
| Molecular Formula | C10H10N4O3 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | [5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]urea |
| SMILES | COc1ccc(-c2nnc(NC(N)=O)o2)cc1 |
| InChI | InChI=1S/C10H10N4O3/c1-16-7-4-2-6(3-5-7)8-13-14-10(17-8)12-9(11)15/h2-5H,1H3,(H3,11,12,14,15) |
| InChIKey | XWKNLELWZYVDHL-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |