C10H11N5O3 — CID 71521325
1-amino-3-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]urea (PubChem CID 71521325) has the molecular formula C10H11N5O3 and a molecular weight of 249.23 g/mol. Its IUPAC name is 1-amino-3-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]urea.
| Compound Name | 1-amino-3-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]urea |
|---|---|
| PubChem CID | 71521325 |
| Molecular Formula | C10H11N5O3 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 1-amino-3-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]urea |
| SMILES | COc1ccc(-c2nnc(NC(=O)NN)o2)cc1 |
| InChI | InChI=1S/C10H11N5O3/c1-17-7-4-2-6(3-5-7)8-14-15-10(18-8)12-9(16)13-11/h2-5H,11H2,1H3,(H2,12,13,15,16) |
| InChIKey | VJUQVNGXFOOAEF-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 115.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|