C14H10N4O6 — CID 5111728
N-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-5-nitrofuran-2-carboxamide (PubChem CID 5111728) has the molecular formula C14H10N4O6 and a molecular weight of 330.26 g/mol. Its IUPAC name is N-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-5-nitrofuran-2-carboxamide.
| Compound Name | N-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 5111728 |
| Molecular Formula | C14H10N4O6 |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | N-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-5-nitrofuran-2-carboxamide |
| SMILES | COc1ccc(-c2nnc(NC(=O)c3ccc([N+](=O)[O-])o3)o2)cc1 |
| InChI | InChI=1S/C14H10N4O6/c1-22-9-4-2-8(3-5-9)13-16-17-14(24-13)15-12(19)10-6-7-11(23-10)18(20)21/h2-7H,1H3,(H,15,17,19) |
| InChIKey | YMRBIMOHSYAHAR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 133.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|