C15H11BrN2O5 — CID 1370156
2-bromo-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-nitrobenzamide (PubChem CID 1370156) has the molecular formula C15H11BrN2O5 and a molecular weight of 379.17 g/mol. Its IUPAC name is 2-bromo-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-nitrobenzamide.
| Compound Name | 2-bromo-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 1370156 |
| Molecular Formula | C15H11BrN2O5 |
| Molecular Weight | 379.17 g/mol |
| Exact Mass | 377.99 |
| IUPAC Name | 2-bromo-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-nitrobenzamide |
| SMILES | O=C(Nc1ccc2c(c1)OCCO2)c1cc([N+](=O)[O-])ccc1Br |
| InChI | InChI=1S/C15H11BrN2O5/c16-12-3-2-10(18(20)21)8-11(12)15(19)17-9-1-4-13-14(7-9)23-6-5-22-13/h1-4,7-8H,5-6H2,(H,17,19) |
| InChIKey | CSEKSRUYOXVRHT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.17 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|