C21H17N5O5 — CID 2966748
1-(2-cyanoethyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(4-nitrophenyl)pyrazole-4-carboxamide (PubChem CID 2966748) has the molecular formula C21H17N5O5 and a molecular weight of 419.40 g/mol. Its IUPAC name is 1-(2-cyanoethyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(4-nitrophenyl)pyrazole-4-carboxamide.
| Compound Name | 1-(2-cyanoethyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(4-nitrophenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 2966748 |
| Molecular Formula | C21H17N5O5 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 1-(2-cyanoethyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(4-nitrophenyl)pyrazole-4-carboxamide |
| SMILES | N#CCCn1cc(C(=O)Nc2ccc([N+](=O)[O-])cc2)c(-c2ccc3c(c2)OCCO3)n1 |
| InChI | InChI=1S/C21H17N5O5/c22-8-1-9-25-13-17(21(27)23-15-3-5-16(6-4-15)26(28)29)20(24-25)14-2-7-18-19(12-14)31-11-10-30-18/h2-7,12-13H,1,9-11H2,(H,23,27) |
| InChIKey | PHTRQMFWMDKGOF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 132.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|