C22H15ClN6O5S2 — CID 155968929
N-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]sulfonyl]-1-(2-cyanoethyl)-3-(4-nitrophenyl)pyrazole-4-carboxamide (PubChem CID 155968929) has the molecular formula C22H15ClN6O5S2 and a molecular weight of 542.99 g/mol. Its IUPAC name is N-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]sulfonyl]-1-(2-cyanoethyl)-3-(4-nitrophenyl)pyrazole-4-carboxamide.
| Compound Name | N-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]sulfonyl]-1-(2-cyanoethyl)-3-(4-nitrophenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 155968929 |
| Molecular Formula | C22H15ClN6O5S2 |
| Molecular Weight | 542.99 g/mol |
| Exact Mass | 542.02 |
| IUPAC Name | N-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]sulfonyl]-1-(2-cyanoethyl)-3-(4-nitrophenyl)pyrazole-4-carboxamide |
| SMILES | N#CCCn1cc(C(=O)NS(=O)(=O)c2csc(-c3ccc(Cl)cc3)n2)c(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C22H15ClN6O5S2/c23-16-6-2-15(3-7-16)22-25-19(13-35-22)36(33,34)27-21(30)18-12-28(11-1-10-24)26-20(18)14-4-8-17(9-5-14)29(31)32/h2-9,12-13H,1,11H2,(H,27,30) |
| InChIKey | PBCSKYHFTRCTMY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 160.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.99 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|