C21H17N5O6 — CID 2474147
3-[[1-(2-cyanoethyl)-3-(4-methoxy-3-nitrophenyl)pyrazole-4-carbonyl]amino]benzoic acid (PubChem CID 2474147) has the molecular formula C21H17N5O6 and a molecular weight of 435.40 g/mol. Its IUPAC name is 3-[[1-(2-cyanoethyl)-3-(4-methoxy-3-nitrophenyl)pyrazole-4-carbonyl]amino]benzoic acid.
| Compound Name | 3-[[1-(2-cyanoethyl)-3-(4-methoxy-3-nitrophenyl)pyrazole-4-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 2474147 |
| Molecular Formula | C21H17N5O6 |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | 3-[[1-(2-cyanoethyl)-3-(4-methoxy-3-nitrophenyl)pyrazole-4-carbonyl]amino]benzoic acid |
| SMILES | COc1ccc(-c2nn(CCC#N)cc2C(=O)Nc2cccc(C(=O)O)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H17N5O6/c1-32-18-7-6-13(11-17(18)26(30)31)19-16(12-25(24-19)9-3-8-22)20(27)23-15-5-2-4-14(10-15)21(28)29/h2,4-7,10-12H,3,9H2,1H3,(H,23,27)(H,28,29) |
| InChIKey | WWVXMUABZKQEKB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 160.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|