C23H14FN5O3 — CID 166792000
1-(4-cyanophenyl)-N-(3-fluorophenyl)-3-(4-nitrophenyl)pyrazole-4-carboxamide (PubChem CID 166792000) has the molecular formula C23H14FN5O3 and a molecular weight of 427.40 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-N-(3-fluorophenyl)-3-(4-nitrophenyl)pyrazole-4-carboxamide.
| Compound Name | 1-(4-cyanophenyl)-N-(3-fluorophenyl)-3-(4-nitrophenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 166792000 |
| Molecular Formula | C23H14FN5O3 |
| Molecular Weight | 427.40 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 1-(4-cyanophenyl)-N-(3-fluorophenyl)-3-(4-nitrophenyl)pyrazole-4-carboxamide |
| SMILES | N#Cc1ccc(-n2cc(C(=O)Nc3cccc(F)c3)c(-c3ccc([N+](=O)[O-])cc3)n2)cc1 |
| InChI | InChI=1S/C23H14FN5O3/c24-17-2-1-3-18(12-17)26-23(30)21-14-28(19-8-4-15(13-25)5-9-19)27-22(21)16-6-10-20(11-7-16)29(31)32/h1-12,14H,(H,26,30) |
| InChIKey | CSFUPYIIPHTGEO-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 113.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.40 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|