C25H15Cl2FN4O2 — CID 159828188
3-[4-(2,2-dichloroacetyl)phenyl]-N-(3-fluorophenyl)-1-(4-isocyanophenyl)pyrazole-4-carboxamide (PubChem CID 159828188) has the molecular formula C25H15Cl2FN4O2 and a molecular weight of 493.33 g/mol. Its IUPAC name is 3-[4-(2,2-dichloroacetyl)phenyl]-N-(3-fluorophenyl)-1-(4-isocyanophenyl)pyrazole-4-carboxamide.
| Compound Name | 3-[4-(2,2-dichloroacetyl)phenyl]-N-(3-fluorophenyl)-1-(4-isocyanophenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 159828188 |
| Molecular Formula | C25H15Cl2FN4O2 |
| Molecular Weight | 493.33 g/mol |
| Exact Mass | 492.06 |
| IUPAC Name | 3-[4-(2,2-dichloroacetyl)phenyl]-N-(3-fluorophenyl)-1-(4-isocyanophenyl)pyrazole-4-carboxamide |
| SMILES | [C-]#[N+]c1ccc(-n2cc(C(=O)Nc3cccc(F)c3)c(-c3ccc(C(=O)C(Cl)Cl)cc3)n2)cc1 |
| InChI | InChI=1S/C25H15Cl2FN4O2/c1-29-18-9-11-20(12-10-18)32-14-21(25(34)30-19-4-2-3-17(28)13-19)22(31-32)15-5-7-16(8-6-15)23(33)24(26)27/h2-14,24H,(H,30,34) |
| InChIKey | NNCQRNUYJPCCAP-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 68.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.33 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|