C21H19Cl2FN4O2 — CID 149497137
3-[[(2,2-dichloroacetyl)-ethylamino]methyl]-N-(3-fluorophenyl)-1-phenylpyrazole-4-carboxamide (PubChem CID 149497137) has the molecular formula C21H19Cl2FN4O2 and a molecular weight of 449.31 g/mol. Its IUPAC name is 3-[[(2,2-dichloroacetyl)-ethylamino]methyl]-N-(3-fluorophenyl)-1-phenylpyrazole-4-carboxamide.
| Compound Name | 3-[[(2,2-dichloroacetyl)-ethylamino]methyl]-N-(3-fluorophenyl)-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 149497137 |
| Molecular Formula | C21H19Cl2FN4O2 |
| Molecular Weight | 449.31 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 3-[[(2,2-dichloroacetyl)-ethylamino]methyl]-N-(3-fluorophenyl)-1-phenylpyrazole-4-carboxamide |
| SMILES | CCN(Cc1nn(-c2ccccc2)cc1C(=O)Nc1cccc(F)c1)C(=O)C(Cl)Cl |
| InChI | InChI=1S/C21H19Cl2FN4O2/c1-2-27(21(30)19(22)23)13-18-17(12-28(26-18)16-9-4-3-5-10-16)20(29)25-15-8-6-7-14(24)11-15/h3-12,19H,2,13H2,1H3,(H,25,29) |
| InChIKey | ZGGMSUURZWLFJJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.31 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|